C17H22O2 — CID 143491361
(4E,6E)-1-(3-methoxyphenyl)deca-4,6-dien-3-one (PubChem CID 143491361) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is (4E,6E)-1-(3-methoxyphenyl)deca-4,6-dien-3-one.
| Compound Name | (4E,6E)-1-(3-methoxyphenyl)deca-4,6-dien-3-one |
|---|---|
| PubChem CID | 143491361 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | (4E,6E)-1-(3-methoxyphenyl)deca-4,6-dien-3-one |
| SMILES | CCC/C=C/C=C/C(=O)CCc1cccc(OC)c1 |
| InChI | InChI=1S/C17H22O2/c1-3-4-5-6-7-10-16(18)13-12-15-9-8-11-17(14-15)19-2/h5-11,14H,3-4,12-13H2,1-2H3/b6-5+,10-7+ |
| InChIKey | IOLPLGMSWLAWGI-WEYXYWBQSA-N |
| XLogP | 4.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|