C18H22N2O2 — CID 101099041
(1S,2S,7R,9S)-2,10,10-trimethyl-5-phenyl-3,5-diazatricyclo[7.1.1.02,7]undecane-4,6-dione (PubChem CID 101099041) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is (1S,2S,7R,9S)-2,10,10-trimethyl-5-phenyl-3,5-diazatricyclo[7.1.1.02,7]undecane-4,6-dione.
| Compound Name | (1S,2S,7R,9S)-2,10,10-trimethyl-5-phenyl-3,5-diazatricyclo[7.1.1.02,7]undecane-4,6-dione |
|---|---|
| PubChem CID | 101099041 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (1S,2S,7R,9S)-2,10,10-trimethyl-5-phenyl-3,5-diazatricyclo[7.1.1.02,7]undecane-4,6-dione |
| SMILES | CC1(C)[C@@H]2C[C@H]3C(=O)N(c4ccccc4)C(=O)N[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C18H22N2O2/c1-17(2)11-9-13-15(21)20(12-7-5-4-6-8-12)16(22)19-18(13,3)14(17)10-11/h4-8,11,13-14H,9-10H2,1-3H3,(H,19,22)/t11-,13+,14+,18-/m1/s1 |
| InChIKey | IQIDGBWLYWIPOW-ZLJVHPLZSA-N |
| XLogP | 3.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |