C27H35NO2Si — CID 125033519
(1R,3S,5R,8R,9S,13R,14R)-1,4,4,8-tetramethyl-11-phenyl-14-trimethylsilyl-11-azapentacyclo[6.5.1.13,5.02,7.09,13]pentadec-2(7)-ene-10,12-dione (PubChem CID 125033519) has the molecular formula C27H35NO2Si and a molecular weight of 433.67 g/mol. Its IUPAC name is (1R,3S,5R,8R,9S,13R,14R)-1,4,4,8-tetramethyl-11-phenyl-14-trimethylsilyl-11-azapentacyclo[6.5.1.13,5.02,7.09,13]pentadec-2(7)-ene-10,12-dione.
| Compound Name | (1R,3S,5R,8R,9S,13R,14R)-1,4,4,8-tetramethyl-11-phenyl-14-trimethylsilyl-11-azapentacyclo[6.5.1.13,5.02,7.09,13]pentadec-2(7)-ene-10,12-dione |
|---|---|
| PubChem CID | 125033519 |
| Molecular Formula | C27H35NO2Si |
| Molecular Weight | 433.67 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | (1R,3S,5R,8R,9S,13R,14R)-1,4,4,8-tetramethyl-11-phenyl-14-trimethylsilyl-11-azapentacyclo[6.5.1.13,5.02,7.09,13]pentadec-2(7)-ene-10,12-dione |
| SMILES | CC1(C)[C@H]2CC3=C([C@H]1C2)[C@]1(C)[C@H]([Si](C)(C)C)[C@]3(C)[C@H]2C(=O)N(c3ccccc3)C(=O)[C@H]21 |
| InChI | InChI=1S/C27H35NO2Si/c1-25(2)15-13-17(25)19-18(14-15)26(3)20-21(27(19,4)24(26)31(5,6)7)23(30)28(22(20)29)16-11-9-8-10-12-16/h8-12,15,17,20-21,24H,13-14H2,1-7H3/t15-,17-,20-,21+,24-,26+,27+/m1/s1 |
| InChIKey | BYKMOYRAJUZBKE-SJGLQHIESA-N |
| XLogP | 5.90 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.67 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|