C19H21NO3S — CID 1207276
(3aS,6aR)-2',2',4',4'-tetramethyl-5-phenylspiro[3a,6a-dihydro-1H-thieno[3,4-c]pyrrole-3,3'-cyclobutane]-1',4,6-trione (PubChem CID 1207276) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is (3aS,6aR)-2',2',4',4'-tetramethyl-5-phenylspiro[3a,6a-dihydro-1H-thieno[3,4-c]pyrrole-3,3'-cyclobutane]-1',4,6-trione.
| Compound Name | (3aS,6aR)-2',2',4',4'-tetramethyl-5-phenylspiro[3a,6a-dihydro-1H-thieno[3,4-c]pyrrole-3,3'-cyclobutane]-1',4,6-trione |
|---|---|
| PubChem CID | 1207276 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | (3aS,6aR)-2',2',4',4'-tetramethyl-5-phenylspiro[3a,6a-dihydro-1H-thieno[3,4-c]pyrrole-3,3'-cyclobutane]-1',4,6-trione |
| SMILES | CC1(C)C(=O)C(C)(C)C12SC[C@H]1C(=O)N(c3ccccc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C19H21NO3S/c1-17(2)16(23)18(3,4)19(17)13-12(10-24-19)14(21)20(15(13)22)11-8-6-5-7-9-11/h5-9,12-13H,10H2,1-4H3/t12-,13+/m1/s1 |
| InChIKey | SWONYBBOHSREGZ-OLZOCXBDSA-N |
| XLogP | 2.91 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|