C23H20N4O2 — CID 134925028
(3R,3aS,6aS)-3-methyl-1,5-diphenyl-3-pyridin-2-yl-3a,6a-dihydro-2H-pyrrolo[3,4-c]pyrazole-4,6-dione (PubChem CID 134925028) has the molecular formula C23H20N4O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is (3R,3aS,6aS)-3-methyl-1,5-diphenyl-3-pyridin-2-yl-3a,6a-dihydro-2H-pyrrolo[3,4-c]pyrazole-4,6-dione.
| Compound Name | (3R,3aS,6aS)-3-methyl-1,5-diphenyl-3-pyridin-2-yl-3a,6a-dihydro-2H-pyrrolo[3,4-c]pyrazole-4,6-dione |
|---|---|
| PubChem CID | 134925028 |
| Molecular Formula | C23H20N4O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (3R,3aS,6aS)-3-methyl-1,5-diphenyl-3-pyridin-2-yl-3a,6a-dihydro-2H-pyrrolo[3,4-c]pyrazole-4,6-dione |
| SMILES | C[C@@]1(c2ccccn2)NN(c2ccccc2)[C@@H]2C(=O)N(c3ccccc3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C23H20N4O2/c1-23(18-14-8-9-15-24-18)19-20(27(25-23)17-12-6-3-7-13-17)22(29)26(21(19)28)16-10-4-2-5-11-16/h2-15,19-20,25H,1H3/t19-,20+,23+/m1/s1 |
| InChIKey | KOOOQZVFEBHSAT-QTEQDKRBSA-N |
| XLogP | 2.88 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|