C21H23NO3 — CID 101031686
(1R,2S,6R,7S)-1,7,8,9,10-pentamethyl-3,5-dioxo-4-phenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-10-carbaldehyde (PubChem CID 101031686) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is (1R,2S,6R,7S)-1,7,8,9,10-pentamethyl-3,5-dioxo-4-phenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-10-carbaldehyde.
| Compound Name | (1R,2S,6R,7S)-1,7,8,9,10-pentamethyl-3,5-dioxo-4-phenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-10-carbaldehyde |
|---|---|
| PubChem CID | 101031686 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (1R,2S,6R,7S)-1,7,8,9,10-pentamethyl-3,5-dioxo-4-phenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-10-carbaldehyde |
| SMILES | CC1=C(C)[C@]2(C)[C@@H]3C(=O)N(c4ccccc4)C(=O)[C@@H]3[C@@]1(C)C2(C)C=O |
| InChI | InChI=1S/C21H23NO3/c1-12-13(2)21(5)16-15(20(12,4)19(21,3)11-23)17(24)22(18(16)25)14-9-7-6-8-10-14/h6-11,15-16H,1-5H3/t15-,16+,19?,20+,21- |
| InChIKey | WIWQRICCPPHHQZ-QHGXQIBWSA-N |
| XLogP | 3.37 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|