C18H16BrNO3 — CID 10109924
(9S)-9-(3-bromo-4-methylphenyl)-3,4,5,6,7,9-hexahydrofuro[3,4-b]quinoline-1,8-dione (PubChem CID 10109924) has the molecular formula C18H16BrNO3 and a molecular weight of 374.23 g/mol. Its IUPAC name is (9S)-9-(3-bromo-4-methylphenyl)-3,4,5,6,7,9-hexahydrofuro[3,4-b]quinoline-1,8-dione.
| Compound Name | (9S)-9-(3-bromo-4-methylphenyl)-3,4,5,6,7,9-hexahydrofuro[3,4-b]quinoline-1,8-dione |
|---|---|
| PubChem CID | 10109924 |
| Molecular Formula | C18H16BrNO3 |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | (9S)-9-(3-bromo-4-methylphenyl)-3,4,5,6,7,9-hexahydrofuro[3,4-b]quinoline-1,8-dione |
| SMILES | Cc1ccc([C@H]2C3=C(CCCC3=O)NC3=C2C(=O)OC3)cc1Br |
| InChI | InChI=1S/C18H16BrNO3/c1-9-5-6-10(7-11(9)19)15-16-12(3-2-4-14(16)21)20-13-8-23-18(22)17(13)15/h5-7,15,20H,2-4,8H2,1H3/t15-/m0/s1 |
| InChIKey | ADGVWYCQHMUREU-HNNXBMFYSA-N |
| XLogP | 3.26 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |