C17H14FNO3 — CID 4859766
9-(4-fluorophenyl)-3,4,5,6,7,9-hexahydrofuro[3,4-b]quinoline-1,8-dione (PubChem CID 4859766) has the molecular formula C17H14FNO3 and a molecular weight of 299.30 g/mol. Its IUPAC name is 9-(4-fluorophenyl)-3,4,5,6,7,9-hexahydrofuro[3,4-b]quinoline-1,8-dione.
| Compound Name | 9-(4-fluorophenyl)-3,4,5,6,7,9-hexahydrofuro[3,4-b]quinoline-1,8-dione |
|---|---|
| PubChem CID | 4859766 |
| Molecular Formula | C17H14FNO3 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 9-(4-fluorophenyl)-3,4,5,6,7,9-hexahydrofuro[3,4-b]quinoline-1,8-dione |
| SMILES | O=C1CCCC2=C1C(c1ccc(F)cc1)C1=C(COC1=O)N2 |
| InChI | InChI=1S/C17H14FNO3/c18-10-6-4-9(5-7-10)14-15-11(2-1-3-13(15)20)19-12-8-22-17(21)16(12)14/h4-7,14,19H,1-3,8H2 |
| InChIKey | YIENUBALWISPDU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |