C11H17IO2 — CID 101100610
(1S,2S,5S,7S)-7-(iodomethyl)-2-prop-2-enoxy-8-oxabicyclo[3.2.1]octane (PubChem CID 101100610) has the molecular formula C11H17IO2 and a molecular weight of 308.16 g/mol. Its IUPAC name is (1S,2S,5S,7S)-7-(iodomethyl)-2-prop-2-enoxy-8-oxabicyclo[3.2.1]octane.
| Compound Name | (1S,2S,5S,7S)-7-(iodomethyl)-2-prop-2-enoxy-8-oxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 101100610 |
| Molecular Formula | C11H17IO2 |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | (1S,2S,5S,7S)-7-(iodomethyl)-2-prop-2-enoxy-8-oxabicyclo[3.2.1]octane |
| SMILES | C=CCO[C@H]1CC[C@H]2C[C@H](CI)[C@@H]1O2 |
| InChI | InChI=1S/C11H17IO2/c1-2-5-13-10-4-3-9-6-8(7-12)11(10)14-9/h2,8-11H,1,3-7H2/t8-,9+,10+,11+/m1/s1 |
| InChIKey | XBKXUEZAVKKPBB-RCWTZXSCSA-N |
| XLogP | 2.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|