C21H32N2O4 — CID 10110086
2-[[1-[(4-butyl-2-pyridinyl)carbamoyl]cyclopentyl]methyl]-4-methoxybutanoic acid (PubChem CID 10110086) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-[[1-[(4-butyl-2-pyridinyl)carbamoyl]cyclopentyl]methyl]-4-methoxybutanoic acid.
| Compound Name | 2-[[1-[(4-butyl-2-pyridinyl)carbamoyl]cyclopentyl]methyl]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 10110086 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 2-[[1-[(4-butyl-2-pyridinyl)carbamoyl]cyclopentyl]methyl]-4-methoxybutanoic acid |
| SMILES | CCCCc1ccnc(NC(=O)C2(CC(CCOC)C(=O)O)CCCC2)c1 |
| InChI | InChI=1S/C21H32N2O4/c1-3-4-7-16-8-12-22-18(14-16)23-20(26)21(10-5-6-11-21)15-17(19(24)25)9-13-27-2/h8,12,14,17H,3-7,9-11,13,15H2,1-2H3,(H,24,25)(H,22,23,26) |
| InChIKey | LZQQBLZDXZIRRO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |