C25H24O2S — CID 101104440
(E)-3-[2-[[3-(2-phenylethylsulfanylmethyl)phenyl]methyl]phenyl]prop-2-enoic acid (PubChem CID 101104440) has the molecular formula C25H24O2S and a molecular weight of 388.53 g/mol. Its IUPAC name is (E)-3-[2-[[3-(2-phenylethylsulfanylmethyl)phenyl]methyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[[3-(2-phenylethylsulfanylmethyl)phenyl]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 101104440 |
| Molecular Formula | C25H24O2S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (E)-3-[2-[[3-(2-phenylethylsulfanylmethyl)phenyl]methyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccccc1Cc1cccc(CSCCc2ccccc2)c1 |
| InChI | InChI=1S/C25H24O2S/c26-25(27)14-13-23-11-4-5-12-24(23)18-21-9-6-10-22(17-21)19-28-16-15-20-7-2-1-3-8-20/h1-14,17H,15-16,18-19H2,(H,26,27)/b14-13+ |
| InChIKey | DWQCKKUPVYFGTE-BUHFOSPRSA-N |
| XLogP | 5.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|