C12H13FO3S — CID 94233243
(E)-3-[2-fluoro-5-(2-hydroxyethylsulfanylmethyl)phenyl]prop-2-enoic acid (PubChem CID 94233243) has the molecular formula C12H13FO3S and a molecular weight of 256.30 g/mol. Its IUPAC name is (E)-3-[2-fluoro-5-(2-hydroxyethylsulfanylmethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-fluoro-5-(2-hydroxyethylsulfanylmethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 94233243 |
| Molecular Formula | C12H13FO3S |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | (E)-3-[2-fluoro-5-(2-hydroxyethylsulfanylmethyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(CSCCO)ccc1F |
| InChI | InChI=1S/C12H13FO3S/c13-11-3-1-9(8-17-6-5-14)7-10(11)2-4-12(15)16/h1-4,7,14H,5-6,8H2,(H,15,16)/b4-2+ |
| InChIKey | HJIYCRGOLSYAKI-DUXPYHPUSA-N |
| XLogP | 2.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|