C13H15FO3S — CID 77112240
3-[5-fluoro-2-(3-hydroxypropylsulfanylmethyl)phenyl]prop-2-enoic acid (PubChem CID 77112240) has the molecular formula C13H15FO3S and a molecular weight of 270.32 g/mol. Its IUPAC name is 3-[5-fluoro-2-(3-hydroxypropylsulfanylmethyl)phenyl]prop-2-enoic acid.
| Compound Name | 3-[5-fluoro-2-(3-hydroxypropylsulfanylmethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77112240 |
| Molecular Formula | C13H15FO3S |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 3-[5-fluoro-2-(3-hydroxypropylsulfanylmethyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cc(F)ccc1CSCCCO |
| InChI | InChI=1S/C13H15FO3S/c14-12-4-2-11(9-18-7-1-6-15)10(8-12)3-5-13(16)17/h2-5,8,15H,1,6-7,9H2,(H,16,17) |
| InChIKey | WZYIJQVXQPYDMG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|