C14H11FN2O2S — CID 77017392
3-[2-fluoro-5-(pyrimidin-4-ylsulfanylmethyl)phenyl]prop-2-enoic acid (PubChem CID 77017392) has the molecular formula C14H11FN2O2S and a molecular weight of 290.32 g/mol. Its IUPAC name is 3-[2-fluoro-5-(pyrimidin-4-ylsulfanylmethyl)phenyl]prop-2-enoic acid.
| Compound Name | 3-[2-fluoro-5-(pyrimidin-4-ylsulfanylmethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77017392 |
| Molecular Formula | C14H11FN2O2S |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 3-[2-fluoro-5-(pyrimidin-4-ylsulfanylmethyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cc(CSc2ccncn2)ccc1F |
| InChI | InChI=1S/C14H11FN2O2S/c15-12-3-1-10(7-11(12)2-4-14(18)19)8-20-13-5-6-16-9-17-13/h1-7,9H,8H2,(H,18,19) |
| InChIKey | YHKZXOVANFICEC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|