C28H24N2 — CID 101107224
3-[1H-indol-3-yl-(4-penta-1,2-dienylphenyl)methyl]-1H-indole (PubChem CID 101107224) has the molecular formula C28H24N2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 3-[1H-indol-3-yl-(4-penta-1,2-dienylphenyl)methyl]-1H-indole.
| Compound Name | 3-[1H-indol-3-yl-(4-penta-1,2-dienylphenyl)methyl]-1H-indole |
|---|---|
| PubChem CID | 101107224 |
| Molecular Formula | C28H24N2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 3-[1H-indol-3-yl-(4-penta-1,2-dienylphenyl)methyl]-1H-indole |
| SMILES | CCC=C=Cc1ccc(C(c2c[nH]c3ccccc23)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C28H24N2/c1-2-3-4-9-20-14-16-21(17-15-20)28(24-18-29-26-12-7-5-10-22(24)26)25-19-30-27-13-8-6-11-23(25)27/h3,5-19,28-30H,2H2,1H3 |
| InChIKey | QMNCATBSVBOGGV-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |