C27H24N2O4 — CID 2907269
2-[4-[bis(1H-indol-3-yl)methyl]-2-ethoxyphenoxy]acetic acid (PubChem CID 2907269) has the molecular formula C27H24N2O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is 2-[4-[bis(1H-indol-3-yl)methyl]-2-ethoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[bis(1H-indol-3-yl)methyl]-2-ethoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 2907269 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 2-[4-[bis(1H-indol-3-yl)methyl]-2-ethoxyphenoxy]acetic acid |
| SMILES | CCOc1cc(C(c2c[nH]c3ccccc23)c2c[nH]c3ccccc23)ccc1OCC(=O)O |
| InChI | InChI=1S/C27H24N2O4/c1-2-32-25-13-17(11-12-24(25)33-16-26(30)31)27(20-14-28-22-9-5-3-7-18(20)22)21-15-29-23-10-6-4-8-19(21)23/h3-15,27-29H,2,16H2,1H3,(H,30,31) |
| InChIKey | ZUOIJRWZRUSWBM-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 87.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |