C25H31NO6 — CID 101107682
benzyl (1R,2S,6R,8S,9R)-9-(2-methoxycarbonylcyclopent-2-en-1-yl)-4,4-dimethyl-3,5-dioxa-11-azatricyclo[6.3.0.02,6]undecane-11-carboxylate (PubChem CID 101107682) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is benzyl (1R,2S,6R,8S,9R)-9-(2-methoxycarbonylcyclopent-2-en-1-yl)-4,4-dimethyl-3,5-dioxa-11-azatricyclo[6.3.0.02,6]undecane-11-carboxylate.
| Compound Name | benzyl (1R,2S,6R,8S,9R)-9-(2-methoxycarbonylcyclopent-2-en-1-yl)-4,4-dimethyl-3,5-dioxa-11-azatricyclo[6.3.0.02,6]undecane-11-carboxylate |
|---|---|
| PubChem CID | 101107682 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | benzyl (1R,2S,6R,8S,9R)-9-(2-methoxycarbonylcyclopent-2-en-1-yl)-4,4-dimethyl-3,5-dioxa-11-azatricyclo[6.3.0.02,6]undecane-11-carboxylate |
| SMILES | COC(=O)C1=CCCC1[C@H]1CN(C(=O)OCc2ccccc2)[C@@H]2[C@H]1C[C@H]1OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C25H31NO6/c1-25(2)31-20-12-18-19(16-10-7-11-17(16)23(27)29-3)13-26(21(18)22(20)32-25)24(28)30-14-15-8-5-4-6-9-15/h4-6,8-9,11,16,18-22H,7,10,12-14H2,1-3H3/t16?,18-,19+,20+,21+,22+/m0/s1 |
| InChIKey | IXVXPDOPMHOKKU-FTJXYRCWSA-N |
| XLogP | 3.67 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |