C19H32O5 — CID 101108313
tert-butyl 2-[[(3aS,4aS,5S,8aR,9aR)-2,2-dimethyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydronaphtho[6,7-d][1,3]dioxol-5-yl]oxy]acetate (PubChem CID 101108313) has the molecular formula C19H32O5 and a molecular weight of 340.46 g/mol. Its IUPAC name is tert-butyl 2-[[(3aS,4aS,5S,8aR,9aR)-2,2-dimethyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydronaphtho[6,7-d][1,3]dioxol-5-yl]oxy]acetate.
| Compound Name | tert-butyl 2-[[(3aS,4aS,5S,8aR,9aR)-2,2-dimethyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydronaphtho[6,7-d][1,3]dioxol-5-yl]oxy]acetate |
|---|---|
| PubChem CID | 101108313 |
| Molecular Formula | C19H32O5 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | tert-butyl 2-[[(3aS,4aS,5S,8aR,9aR)-2,2-dimethyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydronaphtho[6,7-d][1,3]dioxol-5-yl]oxy]acetate |
| SMILES | CC(C)(C)OC(=O)CO[C@H]1CCC[C@@H]2C[C@H]3OC(C)(C)O[C@H]3C[C@@H]21 |
| InChI | InChI=1S/C19H32O5/c1-18(2,3)24-17(20)11-21-14-8-6-7-12-9-15-16(10-13(12)14)23-19(4,5)22-15/h12-16H,6-11H2,1-5H3/t12-,13+,14+,15-,16+/m1/s1 |
| InChIKey | RMCKXLUSCGEJBA-CWVYHPPDSA-N |
| XLogP | 3.44 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |