C19H28O5 — CID 101108560
(1S,2S,4S,5R,10R)-4-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-methoxy-10-methyl-3,6-dioxatricyclo[6.3.0.01,5]undec-8-ene (PubChem CID 101108560) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is (1S,2S,4S,5R,10R)-4-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-methoxy-10-methyl-3,6-dioxatricyclo[6.3.0.01,5]undec-8-ene.
| Compound Name | (1S,2S,4S,5R,10R)-4-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-methoxy-10-methyl-3,6-dioxatricyclo[6.3.0.01,5]undec-8-ene |
|---|---|
| PubChem CID | 101108560 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (1S,2S,4S,5R,10R)-4-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-methoxy-10-methyl-3,6-dioxatricyclo[6.3.0.01,5]undec-8-ene |
| SMILES | CO[C@H]1O[C@H]([C@H]2COC3(CCCCC3)O2)[C@@H]2OCC3=C[C@H](C)C[C@@]312 |
| InChI | InChI=1S/C19H28O5/c1-12-8-13-10-21-16-15(23-17(20-2)19(13,16)9-12)14-11-22-18(24-14)6-4-3-5-7-18/h8,12,14-17H,3-7,9-11H2,1-2H3/t12-,14+,15+,16-,17-,19-/m0/s1 |
| InChIKey | COCONVMDEDQFSL-PJXYTPJLSA-N |
| XLogP | 2.78 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|