C21H31N3O2S — CID 10110916
3-[1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)piperidin-4-yl]-1H-2lambda6,1,3-benzothiadiazole 2,2-dioxide (PubChem CID 10110916) has the molecular formula C21H31N3O2S and a molecular weight of 389.57 g/mol. Its IUPAC name is 3-[1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)piperidin-4-yl]-1H-2lambda6,1,3-benzothiadiazole 2,2-dioxide.
| Compound Name | 3-[1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)piperidin-4-yl]-1H-2lambda6,1,3-benzothiadiazole 2,2-dioxide |
|---|---|
| PubChem CID | 10110916 |
| Molecular Formula | C21H31N3O2S |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 3-[1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)piperidin-4-yl]-1H-2lambda6,1,3-benzothiadiazole 2,2-dioxide |
| SMILES | O=S1(=O)Nc2ccccc2N1C1CCN(C2CCC3CCCCC3C2)CC1 |
| InChI | InChI=1S/C21H31N3O2S/c25-27(26)22-20-7-3-4-8-21(20)24(27)18-11-13-23(14-12-18)19-10-9-16-5-1-2-6-17(16)15-19/h3-4,7-8,16-19,22H,1-2,5-6,9-15H2 |
| InChIKey | PPDCAWVGWRJLLP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |