C24H29N3O2 — CID 10111054
6-(1-ethanimidoylpiperidin-4-yl)oxy-2-(2-phenylethyl)-3,4-dihydroisoquinolin-1-one (PubChem CID 10111054) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 6-(1-ethanimidoylpiperidin-4-yl)oxy-2-(2-phenylethyl)-3,4-dihydroisoquinolin-1-one.
| Compound Name | 6-(1-ethanimidoylpiperidin-4-yl)oxy-2-(2-phenylethyl)-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 10111054 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 6-(1-ethanimidoylpiperidin-4-yl)oxy-2-(2-phenylethyl)-3,4-dihydroisoquinolin-1-one |
| SMILES | [H]/N=C(\C)N1CCC(Oc2ccc3c(c2)CCN(CCc2ccccc2)C3=O)CC1 |
| InChI | InChI=1S/C24H29N3O2/c1-18(25)26-15-11-21(12-16-26)29-22-7-8-23-20(17-22)10-14-27(24(23)28)13-9-19-5-3-2-4-6-19/h2-8,17,21,25H,9-16H2,1H3/b25-18+ |
| InChIKey | WJDJVMUEAYHIPT-XIEYBQDHSA-N |
| XLogP | 3.77 |
| TPSA | 56.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|