C16H30OSi — CID 101111974
tert-butyl-[(5E)-5-ethylidene-2,2-dimethyl-4-methylidenecyclopentyl]oxy-dimethylsilane (PubChem CID 101111974) has the molecular formula C16H30OSi and a molecular weight of 266.50 g/mol. Its IUPAC name is tert-butyl-[(5E)-5-ethylidene-2,2-dimethyl-4-methylidenecyclopentyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(5E)-5-ethylidene-2,2-dimethyl-4-methylidenecyclopentyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 101111974 |
| Molecular Formula | C16H30OSi |
| Molecular Weight | 266.50 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | tert-butyl-[(5E)-5-ethylidene-2,2-dimethyl-4-methylidenecyclopentyl]oxy-dimethylsilane |
| SMILES | C=C1CC(C)(C)C(O[Si](C)(C)C(C)(C)C)/C1=C/C |
| InChI | InChI=1S/C16H30OSi/c1-10-13-12(2)11-16(6,7)14(13)17-18(8,9)15(3,4)5/h10,14H,2,11H2,1,3-9H3/b13-10+ |
| InChIKey | VIGJISNDGGENAT-JLHYYAGUSA-N |
| XLogP | 5.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.50 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|