About tert-butyl-(3-ethenyl-5,5-dimethylcyclopent-2-en-1-yl)oxy-dimethylsilane
tert-butyl-(3-ethenyl-5,5-dimethylcyclopent-2-en-1-yl)oxy-dimethylsilane (PubChem CID 14931225) has the molecular formula C15H28OSi
and a molecular weight of 252.47 g/mol. Its IUPAC name is tert-butyl-(3-ethenyl-5,5-dimethylcyclopent-2-en-1-yl)oxy-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-(3-ethenyl-5,5-dimethylcyclopent-2-en-1-yl)oxy-dimethylsilane |
| PubChem CID | 14931225 |
| Molecular Formula | C15H28OSi |
| Molecular Weight | 252.47 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | tert-butyl-(3-ethenyl-5,5-dimethylcyclopent-2-en-1-yl)oxy-dimethylsilane |
| SMILES | C=CC1=CC(O[Si](C)(C)C(C)(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C15H28OSi/c1-9-12-10-13(15(5,6)11-12)16-17(7,8)14(2,3)4/h9-10,13H,1,11H2,2-8H3 |
| InChIKey | NGOCMCBUUYQEAH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-(3-ethenyl-5,5-dimethylcyclopent-2-en-1-yl)oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-(3-ethenyl-5,5-dimethylcyclopent-2-en-1-yl)oxy-dimethylsilane?
The IUPAC name of tert-butyl-(3-ethenyl-5,5-dimethylcyclopent-2-en-1-yl)oxy-dimethylsilane (CID 14931225) is tert-butyl-(3-ethenyl-5,5-dimethylcyclopent-2-en-1-yl)oxy-dimethylsilane.
What is the SMILES notation for tert-butyl-(3-ethenyl-5,5-dimethylcyclopent-2-en-1-yl)oxy-dimethylsilane?
The canonical SMILES for tert-butyl-(3-ethenyl-5,5-dimethylcyclopent-2-en-1-yl)oxy-dimethylsilane is C=CC1=CC(O[Si](C)(C)C(C)(C)C)C(C)(C)C1.
What is the InChIKey of tert-butyl-(3-ethenyl-5,5-dimethylcyclopent-2-en-1-yl)oxy-dimethylsilane?
The InChIKey is NGOCMCBUUYQEAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28OSi/c1-9-12-10-13(15(5,6)11-12)16-17(7,8)14(2,3)4/h9-10,13H,1,11H2,2-8H3.
What are the key properties of tert-butyl-(3-ethenyl-5,5-dimethylcyclopent-2-en-1-yl)oxy-dimethylsilane?
tert-butyl-(3-ethenyl-5,5-dimethylcyclopent-2-en-1-yl)oxy-dimethylsilane has a molecular weight of 252.47 g/mol, XLogP of 4.92, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-(3-ethenyl-5,5-dimethylcyclopent-2-en-1-yl)oxy-dimethylsilane is sourced from PubChem (CID 14931225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).