C11H20OSi — CID 135042303
[(1S,5R)-2-ethenyl-5-methylcyclopent-2-en-1-yl]oxy-trimethylsilane (PubChem CID 135042303) has the molecular formula C11H20OSi and a molecular weight of 196.37 g/mol. Its IUPAC name is [(1S,5R)-2-ethenyl-5-methylcyclopent-2-en-1-yl]oxy-trimethylsilane.
| Compound Name | [(1S,5R)-2-ethenyl-5-methylcyclopent-2-en-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 135042303 |
| Molecular Formula | C11H20OSi |
| Molecular Weight | 196.37 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | [(1S,5R)-2-ethenyl-5-methylcyclopent-2-en-1-yl]oxy-trimethylsilane |
| SMILES | C=CC1=CC[C@@H](C)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C11H20OSi/c1-6-10-8-7-9(2)11(10)12-13(3,4)5/h6,8-9,11H,1,7H2,2-5H3/t9-,11+/m1/s1 |
| InChIKey | NJYFLOHRNWWXKE-KOLCDFICSA-N |
| XLogP | 3.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|