C15H24N2 — CID 101112064
1-(1-diazo-2,2-dimethylpropyl)adamantane (PubChem CID 101112064) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 1-(1-diazo-2,2-dimethylpropyl)adamantane.
| Compound Name | 1-(1-diazo-2,2-dimethylpropyl)adamantane |
|---|---|
| PubChem CID | 101112064 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 1-(1-diazo-2,2-dimethylpropyl)adamantane |
| SMILES | CC(C)(C)C(=[N+]=[N-])C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H24N2/c1-14(2,3)13(17-16)15-7-10-4-11(8-15)6-12(5-10)9-15/h10-12H,4-9H2,1-3H3 |
| InChIKey | FGZGLQDNCKGKOE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|