C18H23NO5 — CID 101112552
tert-butyl N-[5-ethynyl-2-(4-methoxyphenyl)-1,3-dioxan-5-yl]carbamate (PubChem CID 101112552) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is tert-butyl N-[5-ethynyl-2-(4-methoxyphenyl)-1,3-dioxan-5-yl]carbamate.
| Compound Name | tert-butyl N-[5-ethynyl-2-(4-methoxyphenyl)-1,3-dioxan-5-yl]carbamate |
|---|---|
| PubChem CID | 101112552 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | tert-butyl N-[5-ethynyl-2-(4-methoxyphenyl)-1,3-dioxan-5-yl]carbamate |
| SMILES | C#CC1(NC(=O)OC(C)(C)C)COC(c2ccc(OC)cc2)OC1 |
| InChI | InChI=1S/C18H23NO5/c1-6-18(19-16(20)24-17(2,3)4)11-22-15(23-12-18)13-7-9-14(21-5)10-8-13/h1,7-10,15H,11-12H2,2-5H3,(H,19,20) |
| InChIKey | UIWKSSPMYVICGS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|