C16H22N2O4 — CID 135251327
tert-butyl N-[(2S,3S)-3-(4-methoxyphenyl)-5-oxopyrrolidin-2-yl]carbamate (PubChem CID 135251327) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S)-3-(4-methoxyphenyl)-5-oxopyrrolidin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S)-3-(4-methoxyphenyl)-5-oxopyrrolidin-2-yl]carbamate |
|---|---|
| PubChem CID | 135251327 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | tert-butyl N-[(2S,3S)-3-(4-methoxyphenyl)-5-oxopyrrolidin-2-yl]carbamate |
| SMILES | COc1ccc([C@@H]2CC(=O)N[C@H]2NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H22N2O4/c1-16(2,3)22-15(20)18-14-12(9-13(19)17-14)10-5-7-11(21-4)8-6-10/h5-8,12,14H,9H2,1-4H3,(H,17,19)(H,18,20)/t12-,14-/m0/s1 |
| InChIKey | XXBQZWNTHCWXFW-JSGCOSHPSA-N |
| XLogP | 2.15 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |