C19H29NO4 — CID 136571569
tert-butyl 2-hydroxy-3-[[2-(4-methoxyphenyl)cyclobutyl]amino]-2-methylpropanoate (PubChem CID 136571569) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is tert-butyl 2-hydroxy-3-[[2-(4-methoxyphenyl)cyclobutyl]amino]-2-methylpropanoate.
| Compound Name | tert-butyl 2-hydroxy-3-[[2-(4-methoxyphenyl)cyclobutyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 136571569 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | tert-butyl 2-hydroxy-3-[[2-(4-methoxyphenyl)cyclobutyl]amino]-2-methylpropanoate |
| SMILES | COc1ccc(C2CCC2NCC(C)(O)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H29NO4/c1-18(2,3)24-17(21)19(4,22)12-20-16-11-10-15(16)13-6-8-14(23-5)9-7-13/h6-9,15-16,20,22H,10-12H2,1-5H3 |
| InChIKey | TWTPUXVFKWNUMG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |