About 2-[2-(3,4-dichlorophenyl)benzimidazol-1-yl]-4-methylsulfanyl-N-propan-2-ylbutanamide
2-[2-(3,4-dichlorophenyl)benzimidazol-1-yl]-4-methylsulfanyl-N-propan-2-ylbutanamide (PubChem CID 101112971) has the molecular formula C21H23Cl2N3OS
and a molecular weight of 436.41 g/mol. Its IUPAC name is 2-[2-(3,4-dichlorophenyl)benzimidazol-1-yl]-4-methylsulfanyl-N-propan-2-ylbutanamide.
Molecular Properties
| Compound Name | 2-[2-(3,4-dichlorophenyl)benzimidazol-1-yl]-4-methylsulfanyl-N-propan-2-ylbutanamide |
| PubChem CID | 101112971 |
| Molecular Formula | C21H23Cl2N3OS |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 2-[2-(3,4-dichlorophenyl)benzimidazol-1-yl]-4-methylsulfanyl-N-propan-2-ylbutanamide |
| SMILES | CSCCC(C(=O)NC(C)C)n1c(-c2ccc(Cl)c(Cl)c2)nc2ccccc21 |
| InChI | InChI=1S/C21H23Cl2N3OS/c1-13(2)24-21(27)19(10-11-28-3)26-18-7-5-4-6-17(18)25-20(26)14-8-9-15(22)16(23)12-14/h4-9,12-13,19H,10-11H2,1-3H3,(H,24,27) |
| InChIKey | WDPKMHFBUKIAGJ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(3,4-dichlorophenyl)benzimidazol-1-yl]-4-methylsulfanyl-N-propan-2-ylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,4-dichlorophenyl)benzimidazol-1-yl]-4-methylsulfanyl-N-propan-2-ylbutanamide?
The IUPAC name of 2-[2-(3,4-dichlorophenyl)benzimidazol-1-yl]-4-methylsulfanyl-N-propan-2-ylbutanamide (CID 101112971) is 2-[2-(3,4-dichlorophenyl)benzimidazol-1-yl]-4-methylsulfanyl-N-propan-2-ylbutanamide.
What is the SMILES notation for 2-[2-(3,4-dichlorophenyl)benzimidazol-1-yl]-4-methylsulfanyl-N-propan-2-ylbutanamide?
The canonical SMILES for 2-[2-(3,4-dichlorophenyl)benzimidazol-1-yl]-4-methylsulfanyl-N-propan-2-ylbutanamide is CSCCC(C(=O)NC(C)C)n1c(-c2ccc(Cl)c(Cl)c2)nc2ccccc21.
What is the InChIKey of 2-[2-(3,4-dichlorophenyl)benzimidazol-1-yl]-4-methylsulfanyl-N-propan-2-ylbutanamide?
The InChIKey is WDPKMHFBUKIAGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23Cl2N3OS/c1-13(2)24-21(27)19(10-11-28-3)26-18-7-5-4-6-17(18)25-20(26)14-8-9-15(22)16(23)12-14/h4-9,12-13,19H,10-11H2,1-3H3,(H,24,27).
What are the key properties of 2-[2-(3,4-dichlorophenyl)benzimidazol-1-yl]-4-methylsulfanyl-N-propan-2-ylbutanamide?
2-[2-(3,4-dichlorophenyl)benzimidazol-1-yl]-4-methylsulfanyl-N-propan-2-ylbutanamide has a molecular weight of 436.41 g/mol, XLogP of 5.83, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,4-dichlorophenyl)benzimidazol-1-yl]-4-methylsulfanyl-N-propan-2-ylbutanamide is sourced from PubChem (CID 101112971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).