C21H21N3O2 — CID 142760442
2-[2-(1H-indol-6-yl)benzimidazol-1-yl]-4-methylpentanoic acid (PubChem CID 142760442) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-[2-(1H-indol-6-yl)benzimidazol-1-yl]-4-methylpentanoic acid.
| Compound Name | 2-[2-(1H-indol-6-yl)benzimidazol-1-yl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 142760442 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 2-[2-(1H-indol-6-yl)benzimidazol-1-yl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(C(=O)O)n1c(-c2ccc3cc[nH]c3c2)nc2ccccc21 |
| InChI | InChI=1S/C21H21N3O2/c1-13(2)11-19(21(25)26)24-18-6-4-3-5-16(18)23-20(24)15-8-7-14-9-10-22-17(14)12-15/h3-10,12-13,19,22H,11H2,1-2H3,(H,25,26) |
| InChIKey | FFSGRUFVFWFEAH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |