C26H30ClN3O3 — CID 175290066
(1-carbamoylcyclohexyl) (2S)-2-[2-(4-chlorophenyl)benzimidazol-1-yl]-4-methylpentanoate (PubChem CID 175290066) has the molecular formula C26H30ClN3O3 and a molecular weight of 468.00 g/mol. Its IUPAC name is (1-carbamoylcyclohexyl) (2S)-2-[2-(4-chlorophenyl)benzimidazol-1-yl]-4-methylpentanoate.
| Compound Name | (1-carbamoylcyclohexyl) (2S)-2-[2-(4-chlorophenyl)benzimidazol-1-yl]-4-methylpentanoate |
|---|---|
| PubChem CID | 175290066 |
| Molecular Formula | C26H30ClN3O3 |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | (1-carbamoylcyclohexyl) (2S)-2-[2-(4-chlorophenyl)benzimidazol-1-yl]-4-methylpentanoate |
| SMILES | CC(C)C[C@@H](C(=O)OC1(C(N)=O)CCCCC1)n1c(-c2ccc(Cl)cc2)nc2ccccc21 |
| InChI | InChI=1S/C26H30ClN3O3/c1-17(2)16-22(24(31)33-26(25(28)32)14-6-3-7-15-26)30-21-9-5-4-8-20(21)29-23(30)18-10-12-19(27)13-11-18/h4-5,8-13,17,22H,3,6-7,14-16H2,1-2H3,(H2,28,32)/t22-/m0/s1 |
| InChIKey | IJVIETRIXIHLKF-QFIPXVFZSA-N |
| XLogP | 5.68 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |