C33H37N3O5 — CID 175290023
(1-carbamoylcyclohexyl) 2-[2-(2,4-dimethoxyphenyl)benzimidazol-1-yl]-5-phenylpentanoate (PubChem CID 175290023) has the molecular formula C33H37N3O5 and a molecular weight of 555.68 g/mol. Its IUPAC name is (1-carbamoylcyclohexyl) 2-[2-(2,4-dimethoxyphenyl)benzimidazol-1-yl]-5-phenylpentanoate.
| Compound Name | (1-carbamoylcyclohexyl) 2-[2-(2,4-dimethoxyphenyl)benzimidazol-1-yl]-5-phenylpentanoate |
|---|---|
| PubChem CID | 175290023 |
| Molecular Formula | C33H37N3O5 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | (1-carbamoylcyclohexyl) 2-[2-(2,4-dimethoxyphenyl)benzimidazol-1-yl]-5-phenylpentanoate |
| SMILES | COc1ccc(-c2nc3ccccc3n2C(CCCc2ccccc2)C(=O)OC2(C(N)=O)CCCCC2)c(OC)c1 |
| InChI | InChI=1S/C33H37N3O5/c1-39-24-18-19-25(29(22-24)40-2)30-35-26-15-7-8-16-27(26)36(30)28(17-11-14-23-12-5-3-6-13-23)31(37)41-33(32(34)38)20-9-4-10-21-33/h3,5-8,12-13,15-16,18-19,22,28H,4,9-11,14,17,20-21H2,1-2H3,(H2,34,38) |
| InChIKey | KQKSETOWBTXKFH-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |