C24H28ClN3O3 — CID 141449861
2-chloro-2-cyclohexyl-2-[2-(2,4-dimethoxyphenyl)benzimidazol-1-yl]-N-methylacetamide (PubChem CID 141449861) has the molecular formula C24H28ClN3O3 and a molecular weight of 441.96 g/mol. Its IUPAC name is 2-chloro-2-cyclohexyl-2-[2-(2,4-dimethoxyphenyl)benzimidazol-1-yl]-N-methylacetamide.
| Compound Name | 2-chloro-2-cyclohexyl-2-[2-(2,4-dimethoxyphenyl)benzimidazol-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 141449861 |
| Molecular Formula | C24H28ClN3O3 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 2-chloro-2-cyclohexyl-2-[2-(2,4-dimethoxyphenyl)benzimidazol-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)C(Cl)(C1CCCCC1)n1c(-c2ccc(OC)cc2OC)nc2ccccc21 |
| InChI | InChI=1S/C24H28ClN3O3/c1-26-23(29)24(25,16-9-5-4-6-10-16)28-20-12-8-7-11-19(20)27-22(28)18-14-13-17(30-2)15-21(18)31-3/h7-8,11-16H,4-6,9-10H2,1-3H3,(H,26,29) |
| InChIKey | CGKAFEPRDMGHSJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|