C27H30F3N3O — CID 175290131
2,2-dicyclohexyl-2-[2-(2,3,4-trifluorophenyl)benzimidazol-1-yl]acetamide (PubChem CID 175290131) has the molecular formula C27H30F3N3O and a molecular weight of 469.55 g/mol. Its IUPAC name is 2,2-dicyclohexyl-2-[2-(2,3,4-trifluorophenyl)benzimidazol-1-yl]acetamide.
| Compound Name | 2,2-dicyclohexyl-2-[2-(2,3,4-trifluorophenyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 175290131 |
| Molecular Formula | C27H30F3N3O |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 2,2-dicyclohexyl-2-[2-(2,3,4-trifluorophenyl)benzimidazol-1-yl]acetamide |
| SMILES | NC(=O)C(C1CCCCC1)(C1CCCCC1)n1c(-c2ccc(F)c(F)c2F)nc2ccccc21 |
| InChI | InChI=1S/C27H30F3N3O/c28-20-16-15-19(23(29)24(20)30)25-32-21-13-7-8-14-22(21)33(25)27(26(31)34,17-9-3-1-4-10-17)18-11-5-2-6-12-18/h7-8,13-18H,1-6,9-12H2,(H2,31,34) |
| InChIKey | YVDUYJHIFTZFSJ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|