C31H42N4O — CID 175290161
2,2-dicyclohexyl-2-[2-[4-(diethylamino)phenyl]benzimidazol-1-yl]acetamide (PubChem CID 175290161) has the molecular formula C31H42N4O and a molecular weight of 486.70 g/mol. Its IUPAC name is 2,2-dicyclohexyl-2-[2-[4-(diethylamino)phenyl]benzimidazol-1-yl]acetamide.
| Compound Name | 2,2-dicyclohexyl-2-[2-[4-(diethylamino)phenyl]benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 175290161 |
| Molecular Formula | C31H42N4O |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.34 |
| IUPAC Name | 2,2-dicyclohexyl-2-[2-[4-(diethylamino)phenyl]benzimidazol-1-yl]acetamide |
| SMILES | CCN(CC)c1ccc(-c2nc3ccccc3n2C(C(N)=O)(C2CCCCC2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C31H42N4O/c1-3-34(4-2)26-21-19-23(20-22-26)29-33-27-17-11-12-18-28(27)35(29)31(30(32)36,24-13-7-5-8-14-24)25-15-9-6-10-16-25/h11-12,17-22,24-25H,3-10,13-16H2,1-2H3,(H2,32,36) |
| InChIKey | JBVHACHIWGDYJZ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|