About 2,2-dicyclohexyl-2-[2-(2,6-difluorophenyl)benzimidazol-1-yl]acetamide
2,2-dicyclohexyl-2-[2-(2,6-difluorophenyl)benzimidazol-1-yl]acetamide (PubChem CID 175289983) has the molecular formula C27H31F2N3O
and a molecular weight of 451.56 g/mol. Its IUPAC name is 2,2-dicyclohexyl-2-[2-(2,6-difluorophenyl)benzimidazol-1-yl]acetamide.
Molecular Properties
| Compound Name | 2,2-dicyclohexyl-2-[2-(2,6-difluorophenyl)benzimidazol-1-yl]acetamide |
| PubChem CID | 175289983 |
| Molecular Formula | C27H31F2N3O |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 2,2-dicyclohexyl-2-[2-(2,6-difluorophenyl)benzimidazol-1-yl]acetamide |
| SMILES | NC(=O)C(C1CCCCC1)(C1CCCCC1)n1c(-c2c(F)cccc2F)nc2ccccc21 |
| InChI | InChI=1S/C27H31F2N3O/c28-20-14-9-15-21(29)24(20)25-31-22-16-7-8-17-23(22)32(25)27(26(30)33,18-10-3-1-4-11-18)19-12-5-2-6-13-19/h7-9,14-19H,1-6,10-13H2,(H2,30,33) |
| InChIKey | AVLHRODQCHZIEQ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-dicyclohexyl-2-[2-(2,6-difluorophenyl)benzimidazol-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dicyclohexyl-2-[2-(2,6-difluorophenyl)benzimidazol-1-yl]acetamide?
The IUPAC name of 2,2-dicyclohexyl-2-[2-(2,6-difluorophenyl)benzimidazol-1-yl]acetamide (CID 175289983) is 2,2-dicyclohexyl-2-[2-(2,6-difluorophenyl)benzimidazol-1-yl]acetamide.
What is the SMILES notation for 2,2-dicyclohexyl-2-[2-(2,6-difluorophenyl)benzimidazol-1-yl]acetamide?
The canonical SMILES for 2,2-dicyclohexyl-2-[2-(2,6-difluorophenyl)benzimidazol-1-yl]acetamide is NC(=O)C(C1CCCCC1)(C1CCCCC1)n1c(-c2c(F)cccc2F)nc2ccccc21.
What is the InChIKey of 2,2-dicyclohexyl-2-[2-(2,6-difluorophenyl)benzimidazol-1-yl]acetamide?
The InChIKey is AVLHRODQCHZIEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H31F2N3O/c28-20-14-9-15-21(29)24(20)25-31-22-16-7-8-17-23(22)32(25)27(26(30)33,18-10-3-1-4-11-18)19-12-5-2-6-13-19/h7-9,14-19H,1-6,10-13H2,(H2,30,33).
What are the key properties of 2,2-dicyclohexyl-2-[2-(2,6-difluorophenyl)benzimidazol-1-yl]acetamide?
2,2-dicyclohexyl-2-[2-(2,6-difluorophenyl)benzimidazol-1-yl]acetamide has a molecular weight of 451.56 g/mol, XLogP of 6.32, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dicyclohexyl-2-[2-(2,6-difluorophenyl)benzimidazol-1-yl]acetamide is sourced from PubChem (CID 175289983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).