C20H19FN2O2 — CID 153153541
1-cyclohexyl-2-(2-fluorophenyl)benzimidazole-5-carboxylic acid (PubChem CID 153153541) has the molecular formula C20H19FN2O2 and a molecular weight of 338.38 g/mol. Its IUPAC name is 1-cyclohexyl-2-(2-fluorophenyl)benzimidazole-5-carboxylic acid.
| Compound Name | 1-cyclohexyl-2-(2-fluorophenyl)benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 153153541 |
| Molecular Formula | C20H19FN2O2 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-cyclohexyl-2-(2-fluorophenyl)benzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(-c1ccccc1F)n2C1CCCCC1 |
| InChI | InChI=1S/C20H19FN2O2/c21-16-9-5-4-8-15(16)19-22-17-12-13(20(24)25)10-11-18(17)23(19)14-6-2-1-3-7-14/h4-5,8-12,14H,1-3,6-7H2,(H,24,25) |
| InChIKey | PCEZNUGRNHYEOR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |