C19H16F3N3O — CID 23515639
1-cyclopentyl-2-(2,3,4-trifluorophenyl)benzimidazole-5-carboxamide (PubChem CID 23515639) has the molecular formula C19H16F3N3O and a molecular weight of 359.35 g/mol. Its IUPAC name is 1-cyclopentyl-2-(2,3,4-trifluorophenyl)benzimidazole-5-carboxamide.
| Compound Name | 1-cyclopentyl-2-(2,3,4-trifluorophenyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 23515639 |
| Molecular Formula | C19H16F3N3O |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 1-cyclopentyl-2-(2,3,4-trifluorophenyl)benzimidazole-5-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(-c1ccc(F)c(F)c1F)n2C1CCCC1 |
| InChI | InChI=1S/C19H16F3N3O/c20-13-7-6-12(16(21)17(13)22)19-24-14-9-10(18(23)26)5-8-15(14)25(19)11-3-1-2-4-11/h5-9,11H,1-4H2,(H2,23,26) |
| InChIKey | ZEACROXUURXKCB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|