C29H38N4O — CID 175290170
2,2-dicyclohexyl-2-[2-[3-(dimethylamino)phenyl]benzimidazol-1-yl]acetamide (PubChem CID 175290170) has the molecular formula C29H38N4O and a molecular weight of 458.65 g/mol. Its IUPAC name is 2,2-dicyclohexyl-2-[2-[3-(dimethylamino)phenyl]benzimidazol-1-yl]acetamide.
| Compound Name | 2,2-dicyclohexyl-2-[2-[3-(dimethylamino)phenyl]benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 175290170 |
| Molecular Formula | C29H38N4O |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | 2,2-dicyclohexyl-2-[2-[3-(dimethylamino)phenyl]benzimidazol-1-yl]acetamide |
| SMILES | CN(C)c1cccc(-c2nc3ccccc3n2C(C(N)=O)(C2CCCCC2)C2CCCCC2)c1 |
| InChI | InChI=1S/C29H38N4O/c1-32(2)24-17-11-12-21(20-24)27-31-25-18-9-10-19-26(25)33(27)29(28(30)34,22-13-5-3-6-14-22)23-15-7-4-8-16-23/h9-12,17-20,22-23H,3-8,13-16H2,1-2H3,(H2,30,34) |
| InChIKey | WSSADNCUPZQXRY-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |