C33H33N7O4 — CID 59819688
1-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-N-(4-methoxyphenyl)-2-(2-phenoxyphenyl)benzimidazole-5-carboxamide (PubChem CID 59819688) has the molecular formula C33H33N7O4 and a molecular weight of 591.67 g/mol. Its IUPAC name is 1-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-N-(4-methoxyphenyl)-2-(2-phenoxyphenyl)benzimidazole-5-carboxamide.
| Compound Name | 1-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-N-(4-methoxyphenyl)-2-(2-phenoxyphenyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 59819688 |
| Molecular Formula | C33H33N7O4 |
| Molecular Weight | 591.67 g/mol |
| Exact Mass | 591.26 |
| IUPAC Name | 1-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-N-(4-methoxyphenyl)-2-(2-phenoxyphenyl)benzimidazole-5-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc3c(c2)nc(-c2ccccc2Oc2ccccc2)n3[C@@H](CCCN=C(N)N)C(N)=O)cc1 |
| InChI | InChI=1S/C33H33N7O4/c1-43-23-16-14-22(15-17-23)38-32(42)21-13-18-27-26(20-21)39-31(40(27)28(30(34)41)11-7-19-37-33(35)36)25-10-5-6-12-29(25)44-24-8-3-2-4-9-24/h2-6,8-10,12-18,20,28H,7,11,19H2,1H3,(H2,34,41)(H,38,42)(H4,35,36,37)/t28-/m0/s1 |
| InChIKey | AOVMXFFEJHTOSZ-NDEPHWFRSA-N |
| XLogP | 4.84 |
| TPSA | 172.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.67 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|