C35H46N8O3 — CID 143663503
1-[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-(3-methylphenyl)-N-(3-morpholin-4-ylpropyl)benzimidazole-5-carboxamide;toluene (PubChem CID 143663503) has the molecular formula C35H46N8O3 and a molecular weight of 626.81 g/mol. Its IUPAC name is 1-[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-(3-methylphenyl)-N-(3-morpholin-4-ylpropyl)benzimidazole-5-carboxamide;toluene.
| Compound Name | 1-[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-(3-methylphenyl)-N-(3-morpholin-4-ylpropyl)benzimidazole-5-carboxamide;toluene |
|---|---|
| PubChem CID | 143663503 |
| Molecular Formula | C35H46N8O3 |
| Molecular Weight | 626.81 g/mol |
| Exact Mass | 626.37 |
| IUPAC Name | 1-[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-(3-methylphenyl)-N-(3-morpholin-4-ylpropyl)benzimidazole-5-carboxamide;toluene |
| SMILES | Cc1cccc(-c2nc3cc(C(=O)NCCCN4CCOCC4)ccc3n2C(CCCN=C(N)N)C(N)=O)c1.Cc1ccccc1 |
| InChI | InChI=1S/C28H38N8O3.C7H8/c1-19-5-2-6-20(17-19)26-34-22-18-21(27(38)32-11-4-12-35-13-15-39-16-14-35)8-9-23(22)36(26)24(25(29)37)7-3-10-33-28(30)31;1-7-5-3-2-4-6-7/h2,5-6,8-9,17-18,24H,3-4,7,10-16H2,1H3,(H2,29,37)(H,32,38)(H4,30,31,33);2-6H,1H3 |
| InChIKey | PTUHNEUIHDQJAJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 166.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.81 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|