C38H44N8O2 — CID 59044858
1-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-(4-tert-butylphenyl)-N-(2-phenylethyl)-N-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide (PubChem CID 59044858) has the molecular formula C38H44N8O2 and a molecular weight of 644.82 g/mol. Its IUPAC name is 1-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-(4-tert-butylphenyl)-N-(2-phenylethyl)-N-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide.
| Compound Name | 1-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-(4-tert-butylphenyl)-N-(2-phenylethyl)-N-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 59044858 |
| Molecular Formula | C38H44N8O2 |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 644.36 |
| IUPAC Name | 1-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-(4-tert-butylphenyl)-N-(2-phenylethyl)-N-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide |
| SMILES | CC(C)(C)c1ccc(-c2nc3cc(C(=O)N(CCc4ccccc4)Cc4cccnc4)ccc3n2[C@@H](CCCN=C(N)N)C(N)=O)cc1 |
| InChI | InChI=1S/C38H44N8O2/c1-38(2,3)30-16-13-28(14-17-30)35-44-31-23-29(15-18-32(31)46(35)33(34(39)47)12-8-21-43-37(40)41)36(48)45(25-27-11-7-20-42-24-27)22-19-26-9-5-4-6-10-26/h4-7,9-11,13-18,20,23-24,33H,8,12,19,21-22,25H2,1-3H3,(H2,39,47)(H4,40,41,43)/t33-/m0/s1 |
| InChIKey | WBSQIIDWSYNULX-XIFFEERXSA-N |
| XLogP | 5.36 |
| TPSA | 158.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|