C32H35N3O4 — CID 23516010
2-[4-[benzyl(4-hydroxybutyl)carbamoyl]phenyl]-1-cyclohexylbenzimidazole-5-carboxylic acid (PubChem CID 23516010) has the molecular formula C32H35N3O4 and a molecular weight of 525.65 g/mol. Its IUPAC name is 2-[4-[benzyl(4-hydroxybutyl)carbamoyl]phenyl]-1-cyclohexylbenzimidazole-5-carboxylic acid.
| Compound Name | 2-[4-[benzyl(4-hydroxybutyl)carbamoyl]phenyl]-1-cyclohexylbenzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 23516010 |
| Molecular Formula | C32H35N3O4 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | 2-[4-[benzyl(4-hydroxybutyl)carbamoyl]phenyl]-1-cyclohexylbenzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(-c1ccc(C(=O)N(CCCCO)Cc3ccccc3)cc1)n2C1CCCCC1 |
| InChI | InChI=1S/C32H35N3O4/c36-20-8-7-19-34(22-23-9-3-1-4-10-23)31(37)25-15-13-24(14-16-25)30-33-28-21-26(32(38)39)17-18-29(28)35(30)27-11-5-2-6-12-27/h1,3-4,9-10,13-18,21,27,36H,2,5-8,11-12,19-20,22H2,(H,38,39) |
| InChIKey | LJXNNIPMMBZROV-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|