About 1-cyclohexyl-2-[4-(3,3-diphenylpropoxy)phenyl]benzimidazole-5-carboxylic acid
1-cyclohexyl-2-[4-(3,3-diphenylpropoxy)phenyl]benzimidazole-5-carboxylic acid (PubChem CID 10165388) has the molecular formula C35H34N2O3
and a molecular weight of 530.67 g/mol. Its IUPAC name is 1-cyclohexyl-2-[4-(3,3-diphenylpropoxy)phenyl]benzimidazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 1-cyclohexyl-2-[4-(3,3-diphenylpropoxy)phenyl]benzimidazole-5-carboxylic acid |
| PubChem CID | 10165388 |
| Molecular Formula | C35H34N2O3 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | 1-cyclohexyl-2-[4-(3,3-diphenylpropoxy)phenyl]benzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(-c1ccc(OCCC(c3ccccc3)c3ccccc3)cc1)n2C1CCCCC1 |
| InChI | InChI=1S/C35H34N2O3/c38-35(39)28-18-21-33-32(24-28)36-34(37(33)29-14-8-3-9-15-29)27-16-19-30(20-17-27)40-23-22-31(25-10-4-1-5-11-25)26-12-6-2-7-13-26/h1-2,4-7,10-13,16-21,24,29,31H,3,8-9,14-15,22-23H2,(H,38,39) |
| InChIKey | BBLRNRMVNHGUGI-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cyclohexyl-2-[4-(3,3-diphenylpropoxy)phenyl]benzimidazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-2-[4-(3,3-diphenylpropoxy)phenyl]benzimidazole-5-carboxylic acid?
The IUPAC name of 1-cyclohexyl-2-[4-(3,3-diphenylpropoxy)phenyl]benzimidazole-5-carboxylic acid (CID 10165388) is 1-cyclohexyl-2-[4-(3,3-diphenylpropoxy)phenyl]benzimidazole-5-carboxylic acid.
What is the SMILES notation for 1-cyclohexyl-2-[4-(3,3-diphenylpropoxy)phenyl]benzimidazole-5-carboxylic acid?
The canonical SMILES for 1-cyclohexyl-2-[4-(3,3-diphenylpropoxy)phenyl]benzimidazole-5-carboxylic acid is O=C(O)c1ccc2c(c1)nc(-c1ccc(OCCC(c3ccccc3)c3ccccc3)cc1)n2C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-2-[4-(3,3-diphenylpropoxy)phenyl]benzimidazole-5-carboxylic acid?
The InChIKey is BBLRNRMVNHGUGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H34N2O3/c38-35(39)28-18-21-33-32(24-28)36-34(37(33)29-14-8-3-9-15-29)27-16-19-30(20-17-27)40-23-22-31(25-10-4-1-5-11-25)26-12-6-2-7-13-26/h1-2,4-7,10-13,16-21,24,29,31H,3,8-9,14-15,22-23H2,(H,38,39).
What are the key properties of 1-cyclohexyl-2-[4-(3,3-diphenylpropoxy)phenyl]benzimidazole-5-carboxylic acid?
1-cyclohexyl-2-[4-(3,3-diphenylpropoxy)phenyl]benzimidazole-5-carboxylic acid has a molecular weight of 530.67 g/mol, XLogP of 8.51, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-2-[4-(3,3-diphenylpropoxy)phenyl]benzimidazole-5-carboxylic acid is sourced from PubChem (CID 10165388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).