C29H26N6O3 — CID 23515634
1-cyclohexyl-2-[4-[(quinoxalin-2-ylamino)carbamoyl]phenyl]benzimidazole-5-carboxylic acid (PubChem CID 23515634) has the molecular formula C29H26N6O3 and a molecular weight of 506.57 g/mol. Its IUPAC name is 1-cyclohexyl-2-[4-[(quinoxalin-2-ylamino)carbamoyl]phenyl]benzimidazole-5-carboxylic acid.
| Compound Name | 1-cyclohexyl-2-[4-[(quinoxalin-2-ylamino)carbamoyl]phenyl]benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 23515634 |
| Molecular Formula | C29H26N6O3 |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | 1-cyclohexyl-2-[4-[(quinoxalin-2-ylamino)carbamoyl]phenyl]benzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(-c1ccc(C(=O)NNc3cnc4ccccc4n3)cc1)n2C1CCCCC1 |
| InChI | InChI=1S/C29H26N6O3/c36-28(34-33-26-17-30-22-8-4-5-9-23(22)31-26)19-12-10-18(11-13-19)27-32-24-16-20(29(37)38)14-15-25(24)35(27)21-6-2-1-3-7-21/h4-5,8-17,21H,1-3,6-7H2,(H,31,33)(H,34,36)(H,37,38) |
| InChIKey | MPASMGKOVHHWTD-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|