C27H25N3O3 — CID 23515819
1-cyclopentyl-2-[4-[(4-methylphenyl)carbamoyl]phenyl]benzimidazole-5-carboxylic acid (PubChem CID 23515819) has the molecular formula C27H25N3O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is 1-cyclopentyl-2-[4-[(4-methylphenyl)carbamoyl]phenyl]benzimidazole-5-carboxylic acid.
| Compound Name | 1-cyclopentyl-2-[4-[(4-methylphenyl)carbamoyl]phenyl]benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 23515819 |
| Molecular Formula | C27H25N3O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 1-cyclopentyl-2-[4-[(4-methylphenyl)carbamoyl]phenyl]benzimidazole-5-carboxylic acid |
| SMILES | Cc1ccc(NC(=O)c2ccc(-c3nc4cc(C(=O)O)ccc4n3C3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C27H25N3O3/c1-17-6-13-21(14-7-17)28-26(31)19-10-8-18(9-11-19)25-29-23-16-20(27(32)33)12-15-24(23)30(25)22-4-2-3-5-22/h6-16,22H,2-5H2,1H3,(H,28,31)(H,32,33) |
| InChIKey | AKMHWGROZLRFNT-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |