C26H24N4O3 — CID 155817107
1-cyclohexyl-2-(4-nitrophenyl)-N-phenylbenzimidazole-5-carboxamide (PubChem CID 155817107) has the molecular formula C26H24N4O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is 1-cyclohexyl-2-(4-nitrophenyl)-N-phenylbenzimidazole-5-carboxamide.
| Compound Name | 1-cyclohexyl-2-(4-nitrophenyl)-N-phenylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 155817107 |
| Molecular Formula | C26H24N4O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 1-cyclohexyl-2-(4-nitrophenyl)-N-phenylbenzimidazole-5-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1ccc2c(c1)nc(-c1ccc([N+](=O)[O-])cc1)n2C1CCCCC1 |
| InChI | InChI=1S/C26H24N4O3/c31-26(27-20-7-3-1-4-8-20)19-13-16-24-23(17-19)28-25(29(24)21-9-5-2-6-10-21)18-11-14-22(15-12-18)30(32)33/h1,3-4,7-8,11-17,21H,2,5-6,9-10H2,(H,27,31) |
| InChIKey | BSGLGCDKDRXGGG-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|