C28H28N4O6 — CID 69314430
methyl (2S)-2-[[1-cyclohexyl-2-(furan-3-yl)benzimidazole-5-carbonyl]amino]-3-(4-nitrophenyl)propanoate (PubChem CID 69314430) has the molecular formula C28H28N4O6 and a molecular weight of 516.55 g/mol. Its IUPAC name is methyl (2S)-2-[[1-cyclohexyl-2-(furan-3-yl)benzimidazole-5-carbonyl]amino]-3-(4-nitrophenyl)propanoate.
| Compound Name | methyl (2S)-2-[[1-cyclohexyl-2-(furan-3-yl)benzimidazole-5-carbonyl]amino]-3-(4-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 69314430 |
| Molecular Formula | C28H28N4O6 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | methyl (2S)-2-[[1-cyclohexyl-2-(furan-3-yl)benzimidazole-5-carbonyl]amino]-3-(4-nitrophenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc([N+](=O)[O-])cc1)NC(=O)c1ccc2c(c1)nc(-c1ccoc1)n2C1CCCCC1 |
| InChI | InChI=1S/C28H28N4O6/c1-37-28(34)24(15-18-7-10-22(11-8-18)32(35)36)30-27(33)19-9-12-25-23(16-19)29-26(20-13-14-38-17-20)31(25)21-5-3-2-4-6-21/h7-14,16-17,21,24H,2-6,15H2,1H3,(H,30,33)/t24-/m0/s1 |
| InChIKey | DUSCBICUTGRVRQ-DEOSSOPVSA-N |
| XLogP | 5.22 |
| TPSA | 129.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|