C30H31N3O4 — CID 23515886
2-[3-[(4-butoxyphenyl)carbamoyl]phenyl]-1-cyclopentylbenzimidazole-5-carboxylic acid (PubChem CID 23515886) has the molecular formula C30H31N3O4 and a molecular weight of 497.60 g/mol. Its IUPAC name is 2-[3-[(4-butoxyphenyl)carbamoyl]phenyl]-1-cyclopentylbenzimidazole-5-carboxylic acid.
| Compound Name | 2-[3-[(4-butoxyphenyl)carbamoyl]phenyl]-1-cyclopentylbenzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 23515886 |
| Molecular Formula | C30H31N3O4 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 2-[3-[(4-butoxyphenyl)carbamoyl]phenyl]-1-cyclopentylbenzimidazole-5-carboxylic acid |
| SMILES | CCCCOc1ccc(NC(=O)c2cccc(-c3nc4cc(C(=O)O)ccc4n3C3CCCC3)c2)cc1 |
| InChI | InChI=1S/C30H31N3O4/c1-2-3-17-37-25-14-12-23(13-15-25)31-29(34)21-8-6-7-20(18-21)28-32-26-19-22(30(35)36)11-16-27(26)33(28)24-9-4-5-10-24/h6-8,11-16,18-19,24H,2-5,9-10,17H2,1H3,(H,31,34)(H,35,36) |
| InChIKey | FVFFDVJUPHSOOY-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|