C23H26N2O4 — CID 23515674
1-cyclopentyl-2-(3,4-diethoxyphenyl)benzimidazole-5-carboxylic acid (PubChem CID 23515674) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is 1-cyclopentyl-2-(3,4-diethoxyphenyl)benzimidazole-5-carboxylic acid.
| Compound Name | 1-cyclopentyl-2-(3,4-diethoxyphenyl)benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 23515674 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 1-cyclopentyl-2-(3,4-diethoxyphenyl)benzimidazole-5-carboxylic acid |
| SMILES | CCOc1ccc(-c2nc3cc(C(=O)O)ccc3n2C2CCCC2)cc1OCC |
| InChI | InChI=1S/C23H26N2O4/c1-3-28-20-12-10-15(14-21(20)29-4-2)22-24-18-13-16(23(26)27)9-11-19(18)25(22)17-7-5-6-8-17/h9-14,17H,3-8H2,1-2H3,(H,26,27) |
| InChIKey | YHRZFZOMGHJNRC-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |